Top-k Metric
Overview
The top-k metric is a standard evaluation metric for molecular generation tasks. It measures the average quality of the top k unique molecules from a set of generated candidates, ensuring that duplicate molecules are not counted multiple times.
Note
Uniqueness Constraint
The top-k metric enforces uniqueness by:
- Converting all molecules to canonical SMILES representation
- Removing duplicate molecules
- Selecting the k molecules with the highest scores
Padding Mechanism
If fewer than k unique molecules are available (i.e the model cannot generate as many candidates), the remaining slots are padded with 0.0 scores.
Usage Examples
Basic Usage with SMILES
from molrgen.evaluation.top_k import top_k
# List of generated molecules as SMILES
smiles = [
"CC(C)Cc1ccc(cc1)C(C)C(O)=O",
"c1ccccc1",
"CCO",
"CC(C)Cc1ccc(cc1)C(C)C(=O)O" # Ibuprofen duplicate but different smiles
]
# Docking scores for each molecule
scores = [8.5, 6.2, 6.1, 8.5]
# Calculate top-2 score
metric = top_k(smiles, scores, k=2)
print(f"Top-2 score: {metric}")
# Output:
# >>> 7.35
Using RDKit Mol Objects
from molrgen.evaluation.top_k import top_k
from rdkit import Chem
# Convert to Mol objects
mols = [Chem.MolFromSmiles(smi) for smi in smiles]
# top_k automatically canonicalizes Mol objects
metric = top_k(mols, scores, k=2)
print(metric)
# Output:
# >>> 7.35
Without Canonicalization
# If SMILES strings are already canonical
metric = top_k(smiles, scores, k=2, canonicalize=False)
print(metric)
# Output:
# >>> 8.5 # Since both ibuprofen entries are considered unique without canonicalization
Function Reference
Top-k evaluation metric for molecular generation tasks.
This module implements the standard top-k metric for evaluating molecular generation models. The metric measures the average quality of the top k unique molecules from a set of generated candidates.
top_k(mols, scores, k, canonicalize=True)
Calculate the top-k metric for molecular generation.
This function computes the average score of the top k unique molecules from a set of candidates. It first deduplicates molecules using canonical SMILES representation, then selects the k molecules with the highest scores. This metric is useful for evaluating the quality of generated molecules.
Parameters:
| Name | Type | Description | Default |
|---|---|---|---|
mols
|
List[str] | List[Mol]
|
List of molecules as SMILES strings or RDKit Mol objects. |
required |
scores
|
List[float]
|
List of scores corresponding to each molecule (e.g., docking scores, binding affinity). Must have the same length as mols. |
required |
k
|
int
|
Number of top molecules to consider. If fewer than k unique molecules are provided, the remaining slots are filled with 0.0 scores. |
required |
canonicalize
|
bool
|
Whether to canonicalize SMILES strings before comparison. If True, molecules are converted to canonical SMILES for deduplication. Default is True. |
True
|
Returns:
| Type | Description |
|---|---|
float
|
Average score of the top k unique molecules. If fewer than k unique molecules |
float
|
are available, the average includes padding with 0.0 scores. |
Raises:
| Type | Description |
|---|---|
AssertionError
|
If mols and scores have different lengths. |
Example
from molrgen.evaluation.top_k import top_k
from rdkit import Chem
# Using SMILES strings
smiles = ["CC(C)Cc1ccc(cc1)C(C)C(O)=O", "c1ccccc1"]
scores = [8.5, 7.2]
metric = top_k(smiles, scores, k=2)
print(f"Top-2 score: {metric}")
# Using RDKit Mol objects
mols = [Chem.MolFromSmiles(smi) for smi in smiles]
metric = top_k(mols, scores, k=2)
Notes
- Duplicate molecules are automatically detected and removed using canonical SMILES
- If k is larger than the number of unique molecules, remaining slots are filled with 0.0
- The final metric is the average of the k highest scores
Source code in molrgen/evaluation/top_k.py
Benchmark Context
In the MolRGen project, the top-k metric is used to evaluate molecular generation models on raw-quality without diversity constraints. We assess how well a model can generate multiple high-scoring molecules, possibly from a same chemical serie.
See Diversity-Aware Top-k for a variant that also enforces chemical diversity.